Products 2248342-81-4
CAS 2248342-81-4 is the registry number for rac-(3R,4R)-1-((tert-Butoxy)carbonyl)-4-cyclopentylpyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,4S)-4-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2248342-81-4) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: (3S,4S)-4-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: BXHXRUYOHJRSRO-NWDGAFQWSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | (3S,4S)-4-cyclopentyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | BXHXRUYOHJRSRO-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)O)C2CCCC2 |
Computed by PubChem (NCBI)