Products 2248405-07-2

CAS 2248405-07-2 is the registry number for 3-(Difluoromethyl)-5-fluorobenzoic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.

3-(difluoromethyl)-5-fluorobenzoic acid (CAS 2248405-07-2) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 3-(difluoromethyl)-5-fluorobenzoic acid. InChIKey: RZXIDADGPWMBDO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5F3O2
Molecular weight190.12 g/mol
IUPAC name3-(difluoromethyl)-5-fluorobenzoic acid
InChIKeyRZXIDADGPWMBDO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)F)C(F)F

Computed by PubChem (NCBI)