CAS 2248628-92-2 appears in our catalog under these names: Elagolix Impurity 4, Elagolix Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R)-2-(2-oxopyrrolidin-1-yl)-2-phenylethyl] 4-methylbenzenesulfonate (CAS 2248628-92-2) is a chemical compound with the molecular formula C19H21NO4S and a molecular weight of 359.4 g/mol. IUPAC name: [(2R)-2-(2-oxopyrrolidin-1-yl)-2-phenylethyl] 4-methylbenzenesulfonate. InChIKey: TYWRIJNCAHEJRL-SFHVURJKSA-N.
| Molecular formula | C19H21NO4S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | [(2R)-2-(2-oxopyrrolidin-1-yl)-2-phenylethyl] 4-methylbenzenesulfonate |
| InChIKey | TYWRIJNCAHEJRL-SFHVURJKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C2=CC=CC=C2)N3CCCC3=O |
Computed by PubChem (NCBI)