Products 84255-02-7

CAS 84255-02-7 is the registry number for 4-phenyl-1-(p-tolylsulphonyl)piperidine-4-carboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid (CAS 84255-02-7) is a chemical compound with the molecular formula C19H21NO4S and a molecular weight of 359.4 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid. InChIKey: RUPQNAVADOVYKW-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21NO4S
Molecular weight359.4 g/mol
IUPAC name1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carboxylic acid
InChIKeyRUPQNAVADOVYKW-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)(C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)