Products 224961-34-6

CAS 224961-34-6 is the registry number for SB 235375, 98.13%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 5 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-[2-phenyl-4-[[(1S)-1-phenylpropyl]carbamoyl]quinolin-3-yl]oxyacetic acid (CAS 224961-34-6) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: 2-[2-phenyl-4-[[(1S)-1-phenylpropyl]carbamoyl]quinolin-3-yl]oxyacetic acid. InChIKey: RJIWGNBRTQFKBW-NRFANRHFSA-N.

Identity
Molecular formulaC27H24N2O4
Molecular weight440.5 g/mol
IUPAC name2-[2-phenyl-4-[[(1S)-1-phenylpropyl]carbamoyl]quinolin-3-yl]oxyacetic acid
InChIKeyRJIWGNBRTQFKBW-NRFANRHFSA-N
SMILESCC[C@@H](C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)OCC(=O)O

Computed by PubChem (NCBI)