CAS 2249922-12-9 is the registry number for 2,3,4-Tri-O-benzyl-D-xylopyranose. Offered by: Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg.
(3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol (CAS 2249922-12-9) is a chemical compound with the molecular formula C26H28O5 and a molecular weight of 420.5 g/mol. IUPAC name: (3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol. InChIKey: HTSKDJMXBBFKKG-SIDNZMCZSA-N.
| Molecular formula | C26H28O5 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | (3R,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| InChIKey | HTSKDJMXBBFKKG-SIDNZMCZSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](C(O1)O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)