CAS 2250043-10-6 is the registry number for 1-Methyl-10H-phenoxazine 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-methyl-10H-phenoxazine (CAS 2250043-10-6) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 1-methyl-10H-phenoxazine. InChIKey: KVWFIDBERNZLSZ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 1-methyl-10H-phenoxazine |
| InChIKey | KVWFIDBERNZLSZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)