Products 2250241-86-0

CAS 2250241-86-0 appears in our catalog under these names: (3,4-DIFLUOROPHENYL)(PHENYL)METHANAMINE HCL, 98%, (3,4-Difluorophenyl)(phenyl)methanamine hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(3,4-difluorophenyl)-phenylmethanamine;hydrochloride (CAS 2250241-86-0) is a chemical compound with the molecular formula C13H12ClF2N and a molecular weight of 255.69 g/mol. IUPAC name: (3,4-difluorophenyl)-phenylmethanamine;hydrochloride. InChIKey: IWUQKBNQDXJMHG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClF2N
Molecular weight255.69 g/mol
IUPAC name(3,4-difluorophenyl)-phenylmethanamine;hydrochloride
InChIKeyIWUQKBNQDXJMHG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC(=C(C=C2)F)F)N.Cl

Computed by PubChem (NCBI)