CAS 958643-31-7 is the registry number for N-(2-Chloro-2,2-difluoroethyl)-1-naphthalenemethanamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-chloro-2,2-difluoro-N-(naphthalen-1-ylmethyl)ethanamine (CAS 958643-31-7) is a chemical compound with the molecular formula C13H12ClF2N and a molecular weight of 255.69 g/mol. IUPAC name: 2-chloro-2,2-difluoro-N-(naphthalen-1-ylmethyl)ethanamine. InChIKey: AVEFINQMOUQUAY-UHFFFAOYSA-N.
| Molecular formula | C13H12ClF2N |
|---|---|
| Molecular weight | 255.69 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-N-(naphthalen-1-ylmethyl)ethanamine |
| InChIKey | AVEFINQMOUQUAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CNCC(F)(F)Cl |
Computed by PubChem (NCBI)