CAS 2250242-15-8 is the registry number for Lamotrigine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]-2,3-dichlorobenzamide (CAS 2250242-15-8) is a chemical compound with the molecular formula C16H9Cl4N5O and a molecular weight of 429.1 g/mol. IUPAC name: N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]-2,3-dichlorobenzamide. InChIKey: JHCWSDOIAHMCNG-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl4N5O |
|---|---|
| Molecular weight | 429.1 g/mol |
| IUPAC name | N-[3-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-5-yl]-2,3-dichlorobenzamide |
| InChIKey | JHCWSDOIAHMCNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=C(N=N2)N)NC(=O)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)