CAS 252186-79-1 appears in our catalog under these names: 3-(2,3-Dichlorobenzamido) lamotrigine, 95%, Lamotrigine Impurity F, Lamotrigine EP Impurity F, 3-(2,3-Dichlorobenzamido) Lamotrigine, >95% (HPLC), N-(5-Amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl)-2,3-dichlorobenzamide. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 100mg, 250mg, on request, 500mg, 50mg, 25mg, 1000mg.
N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-2,3-dichlorobenzamide (CAS 252186-79-1) is a chemical compound with the molecular formula C16H9Cl4N5O and a molecular weight of 429.1 g/mol. IUPAC name: N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-2,3-dichlorobenzamide. InChIKey: RDUGDEWOUWFKPL-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl4N5O |
|---|---|
| Molecular weight | 429.1 g/mol |
| IUPAC name | N-[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-2,3-dichlorobenzamide |
| InChIKey | RDUGDEWOUWFKPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=C(N=N2)NC(=O)C3=C(C(=CC=C3)Cl)Cl)N |
Computed by PubChem (NCBI)