Products 2250254-19-2
CAS 2250254-19-2 appears in our catalog under these names: Sumatriptan 3-hydroxy-2-oxo impurity, Sumatriptan Hydroxy-Oxindole Impurity (Sumatriptan Impurity 1), Sumatriptan hydroxy oxindole, Tazobactam diphenylmethyl ester. Offered by: Biosynth, TRC, Sigma-Aldrich. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 5mg, 25MG.
1-[3-[2-(dimethylamino)ethyl]-3-hydroxy-2-oxo-1H-indol-5-yl]-N-methylmethanesulfonamide (CAS 2250254-19-2) is a chemical compound with the molecular formula C14H21N3O4S and a molecular weight of 327.40 g/mol. IUPAC name: 1-[3-[2-(dimethylamino)ethyl]-3-hydroxy-2-oxo-1H-indol-5-yl]-N-methylmethanesulfonamide. InChIKey: FLAQITBAWQMBLR-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O4S |
|---|---|
| Molecular weight | 327.40 g/mol |
| IUPAC name | 1-[3-[2-(dimethylamino)ethyl]-3-hydroxy-2-oxo-1H-indol-5-yl]-N-methylmethanesulfonamide |
| InChIKey | FLAQITBAWQMBLR-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC2=C(C=C1)NC(=O)C2(CCN(C)C)O |
Computed by PubChem (NCBI)