CAS 428830-45-9 is the registry number for 1–(4–Nitrobenzyl)–4–(propylsulfonyl)piperazine. Offered by: GLPBio. Available pack sizes: 100mg.
1-[(4-nitrophenyl)methyl]-4-propylsulfonylpiperazine (CAS 428830-45-9) is a chemical compound with the molecular formula C14H21N3O4S and a molecular weight of 327.40 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]-4-propylsulfonylpiperazine. InChIKey: UWWULTFASUQHHK-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O4S |
|---|---|
| Molecular weight | 327.40 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]-4-propylsulfonylpiperazine |
| InChIKey | UWWULTFASUQHHK-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)N1CCN(CC1)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)