CAS 2250340-61-3 is the registry number for (2-Methyl-1,2,3,4-tetrahydroisoquinolin-8-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methyl-3,4-dihydro-1H-isoquinolin-8-yl)boronic acid (CAS 2250340-61-3) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: (2-methyl-3,4-dihydro-1H-isoquinolin-8-yl)boronic acid. InChIKey: TXYZIPMKUBZSEW-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | (2-methyl-3,4-dihydro-1H-isoquinolin-8-yl)boronic acid |
| InChIKey | TXYZIPMKUBZSEW-UHFFFAOYSA-N |
| SMILES | B(C1=C2CN(CCC2=CC=C1)C)(O)O |
Computed by PubChem (NCBI)