Products 869901-52-0
CAS 869901-52-0 appears in our catalog under these names: Pyridine-4-boronic acid, neopentyl ester, 98%, Pyridine， 4–(5，5–dimethyl–1，3，2–dioxaborinan–2–yl)–, 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)pyridine 98%, Pyridine-4-boronic acid, neopentyl ester, 98%, 98%, 4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)pyridine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine (CAS 869901-52-0) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine. InChIKey: HDQULWCYQQMIJJ-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyridine |
| InChIKey | HDQULWCYQQMIJJ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=NC=C2 |
Computed by PubChem (NCBI)