CAS 2250341-24-1 appears in our catalog under these names: 4,4'-(Naphthalene-1,4-diyl)bis(2-hydroxybenzoic acid) 95%, 4,4'-(Naphthalene-1,4-diyl)bis(2-hydroxybenzoic acid), 95%, 95%, 4,4'-(Naphthalene-1,4-diyl)bis(2-hydroxybenzoic acid), 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-carboxy-3-hydroxyphenyl)naphthalen-1-yl]-2-hydroxybenzoic acid (CAS 2250341-24-1) is a chemical compound with the molecular formula C24H16O6 and a molecular weight of 400.4 g/mol. IUPAC name: 4-[4-(4-carboxy-3-hydroxyphenyl)naphthalen-1-yl]-2-hydroxybenzoic acid. InChIKey: XUGAOYQDVRJHRT-UHFFFAOYSA-N.
| Molecular formula | C24H16O6 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 4-[4-(4-carboxy-3-hydroxyphenyl)naphthalen-1-yl]-2-hydroxybenzoic acid |
| InChIKey | XUGAOYQDVRJHRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C3=CC(=C(C=C3)C(=O)O)O)C4=CC(=C(C=C4)C(=O)O)O |
Computed by PubChem (NCBI)