CAS 2252148-07-3 is the registry number for 2-(Benzo(b)thiophen-5-yl)ethan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(1-benzothiophen-5-yl)ethanamine;hydrochloride (CAS 2252148-07-3) is a chemical compound with the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. IUPAC name: 2-(1-benzothiophen-5-yl)ethanamine;hydrochloride. InChIKey: IOEBJMWIFOMEGN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNS |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 2-(1-benzothiophen-5-yl)ethanamine;hydrochloride |
| InChIKey | IOEBJMWIFOMEGN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CS2)C=C1CCN.Cl |
Computed by PubChem (NCBI)