CAS 885527-44-6 is the registry number for 7-Chloro-2-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-chloro-2-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine (CAS 885527-44-6) is a chemical compound with the molecular formula C10H12ClNS and a molecular weight of 213.73 g/mol. IUPAC name: 7-chloro-2-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine. InChIKey: AXBYTSPCCHOVFT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNS |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 7-chloro-2-methyl-2,3,4,5-tetrahydro-1,5-benzothiazepine |
| InChIKey | AXBYTSPCCHOVFT-UHFFFAOYSA-N |
| SMILES | CC1CCNC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)