Products 2252153-95-8

CAS 2252153-95-8 is the registry number for Salbutamol EP Impurity H HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride (CAS 2252153-95-8) is a chemical compound with the molecular formula C13H22ClNO and a molecular weight of 243.77 g/mol. IUPAC name: 4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride. InChIKey: LQQXWMPEGJOQLN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22ClNO
Molecular weight243.77 g/mol
IUPAC name4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride
InChIKeyLQQXWMPEGJOQLN-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)CCNC(C)(C)C)O.Cl

Computed by PubChem (NCBI)