CAS 2252153-95-8 is the registry number for Salbutamol EP Impurity H HCl. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride (CAS 2252153-95-8) is a chemical compound with the molecular formula C13H22ClNO and a molecular weight of 243.77 g/mol. IUPAC name: 4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride. InChIKey: LQQXWMPEGJOQLN-UHFFFAOYSA-N.
| Molecular formula | C13H22ClNO |
|---|---|
| Molecular weight | 243.77 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)ethyl]-2-methylphenol;hydrochloride |
| InChIKey | LQQXWMPEGJOQLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CCNC(C)(C)C)O.Cl |
Computed by PubChem (NCBI)