CAS 58917-77-4 is the registry number for (R*,R*)-(±)-N,N-Diethyl Norephedrine Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
(1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol;hydrochloride (CAS 58917-77-4) is a chemical compound with the molecular formula C13H22ClNO and a molecular weight of 243.77 g/mol. IUPAC name: (1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol;hydrochloride. InChIKey: KOCKBNBCNQXAJH-STEACBGWSA-N.
| Molecular formula | C13H22ClNO |
|---|---|
| Molecular weight | 243.77 g/mol |
| IUPAC name | (1S,2S)-2-(diethylamino)-1-phenylpropan-1-ol;hydrochloride |
| InChIKey | KOCKBNBCNQXAJH-STEACBGWSA-N |
| SMILES | CCN(CC)[C@@H](C)[C@H](C1=CC=CC=C1)O.Cl |
Computed by PubChem (NCBI)