Products 2252168-06-0
CAS 2252168-06-0 appears in our catalog under these names: Pyrene azide 3, Pyrene azide 3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, 25mg, 5mg, 500mg, Get quote.
N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-pyren-1-ylbutanamide (CAS 2252168-06-0) is a chemical compound with the molecular formula C26H28N4O3 and a molecular weight of 444.5 g/mol. IUPAC name: N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-pyren-1-ylbutanamide. InChIKey: DXXWPTFNJXUJQL-UHFFFAOYSA-N.
| Molecular formula | C26H28N4O3 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-4-pyren-1-ylbutanamide |
| InChIKey | DXXWPTFNJXUJQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)NCCOCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)