CAS 2252271-96-6 is the registry number for RIPK1-IN-26. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,2-dimethylbutan-1-one (CAS 2252271-96-6) is a chemical compound with the molecular formula C15H20FNO2 and a molecular weight of 265.32 g/mol. IUPAC name: 1-(7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,2-dimethylbutan-1-one. InChIKey: JTGFKPBXGASRSI-UHFFFAOYSA-N.
| Molecular formula | C15H20FNO2 |
|---|---|
| Molecular weight | 265.32 g/mol |
| IUPAC name | 1-(7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,2-dimethylbutan-1-one |
| InChIKey | JTGFKPBXGASRSI-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(=O)N1CCOC2=C(C1)C=C(C=C2)F |
Computed by PubChem (NCBI)