Products 2252395-44-9
CAS 2252395-44-9 appears in our catalog under these names: J22352, J22352, 99.04%, J22352, 98.72%. Offered by: TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 2mg, 50mg, 100mg, 50 mg, 10mM/1mL, 10 mg, 5 mg, 100 mg.
4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-hydroxybenzamide (CAS 2252395-44-9) is a chemical compound with the molecular formula C24H21N3O4 and a molecular weight of 415.4 g/mol. IUPAC name: 4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-hydroxybenzamide. InChIKey: JBJIKUXUKSADFV-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O4 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 4-[[2,4-dioxo-3-(2-phenylethyl)quinazolin-1-yl]methyl]-N-hydroxybenzamide |
| InChIKey | JBJIKUXUKSADFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C(=O)C3=CC=CC=C3N(C2=O)CC4=CC=C(C=C4)C(=O)NO |
Computed by PubChem (NCBI)