CAS 22531-59-5 is the registry number for 5-Bromo-1-naphthamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromonaphthalene-1-carboxamide (CAS 22531-59-5) is a chemical compound with the molecular formula C11H8BrNO and a molecular weight of 250.09 g/mol. IUPAC name: 5-bromonaphthalene-1-carboxamide. InChIKey: LACXAOKQABXJRX-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 5-bromonaphthalene-1-carboxamide |
| InChIKey | LACXAOKQABXJRX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)C(=O)N |
Computed by PubChem (NCBI)