Products 2253105-16-5
CAS 2253105-16-5 is the registry number for (3R,4R)-Methyl 4-methylpiperidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R,4R)-4-methylpiperidine-3-carboxylate (CAS 2253105-16-5) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (3R,4R)-4-methylpiperidine-3-carboxylate. InChIKey: OGSFGBNZYUWVFP-RQJHMYQMSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (3R,4R)-4-methylpiperidine-3-carboxylate |
| InChIKey | OGSFGBNZYUWVFP-RQJHMYQMSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)