CAS 22536-03-4 appears in our catalog under these names: N-(4-Nitrobenzoyl)glutamic acid, 95%, 2-(4-Nitrobenzamido)pentanedioic acid, 95%, 2-(4-Nitrobenzamido)pentanedioic acid, 95%, 95%, N-(p-Nitrobenzoyl)glutamic Acid, >95% (HPLC). Offered by: Combi-blocks, Fluorochem, Chemat, TRC. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg, 2,5g.
2-[(4-nitrobenzoyl)amino]pentanedioic acid (CAS 22536-03-4) is a chemical compound with the molecular formula C12H12N2O7 and a molecular weight of 296.23 g/mol. IUPAC name: 2-[(4-nitrobenzoyl)amino]pentanedioic acid. InChIKey: NOJZBJAFCSWMKC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O7 |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | 2-[(4-nitrobenzoyl)amino]pentanedioic acid |
| InChIKey | NOJZBJAFCSWMKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)