CAS 6758-40-3 appears in our catalog under these names: (S)-2-(4-Nitrobenzamido)pentanedioic acid, 97%, N-(4-Nitrobenzoyl)-l-glutamic acid hemihydrate, 95%, N-(4-Nitrobenzoyl)-L-glutamic Acid, >95% (HPLC), (S)-2-(4-Nitrobenzamido)pentanedioic acid, 98%, (S)–2–(4–Nitrobenzamido)pentanedioic acid. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g, 250mg.
2-[(4-nitrobenzoyl)amino]pentanedioic acid (CAS 6758-40-3) is a chemical compound with the molecular formula C12H12N2O7 and a molecular weight of 296.23 g/mol. IUPAC name: 2-[(4-nitrobenzoyl)amino]pentanedioic acid. InChIKey: NOJZBJAFCSWMKC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O7 |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | 2-[(4-nitrobenzoyl)amino]pentanedioic acid |
| InChIKey | NOJZBJAFCSWMKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)