Products 2253629-94-4

CAS 2253629-94-4 is the registry number for 4-Methylbenzene-1-sulfonic acid, bicyclo(2.1.0)pentan-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Bicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid (CAS 2253629-94-4) is a chemical compound with the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. IUPAC name: bicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid. InChIKey: WQNOLMKFOGJZMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO3S
Molecular weight255.34 g/mol
IUPAC namebicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid
InChIKeyWQNOLMKFOGJZMZ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1CC2C1C2N

Computed by PubChem (NCBI)