CAS 2253629-94-4 is the registry number for 4-Methylbenzene-1-sulfonic acid, bicyclo(2.1.0)pentan-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Bicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid (CAS 2253629-94-4) is a chemical compound with the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. IUPAC name: bicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid. InChIKey: WQNOLMKFOGJZMZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | bicyclo[2.1.0]pentan-5-amine;4-methylbenzenesulfonic acid |
| InChIKey | WQNOLMKFOGJZMZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1CC2C1C2N |
Computed by PubChem (NCBI)