Products 2253630-54-3
CAS 2253630-54-3 is the registry number for 1-{1-Phenyl-2-azabicyclo(2.1.1)hexan-2-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1-phenyl-2-azabicyclo[2.1.1]hexan-2-yl)ethanone (CAS 2253630-54-3) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 1-(1-phenyl-2-azabicyclo[2.1.1]hexan-2-yl)ethanone. InChIKey: DNIZMLQJNKDOCW-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 1-(1-phenyl-2-azabicyclo[2.1.1]hexan-2-yl)ethanone |
| InChIKey | DNIZMLQJNKDOCW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC1(C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)