CAS 2253632-45-8 is the registry number for 5-(2-Aminoethyl)-1-methyl-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2-aminoethyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one;hydrochloride (CAS 2253632-45-8) is a chemical compound with the molecular formula C8H12ClN5O and a molecular weight of 229.67 g/mol. IUPAC name: 5-(2-aminoethyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one;hydrochloride. InChIKey: BXDVUPCPNIWFHK-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN5O |
|---|---|
| Molecular weight | 229.67 g/mol |
| IUPAC name | 5-(2-aminoethyl)-1-methylpyrazolo[5,4-d]pyrimidin-4-one;hydrochloride |
| InChIKey | BXDVUPCPNIWFHK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C=N2)CCN.Cl |
Computed by PubChem (NCBI)