CAS 83364-15-2 is the registry number for 2-Chloro-4-acetamido-6-(isopropylamino)-s-triazine. Offered by: TRC. Available pack sizes: 2,5g.
N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]acetamide (CAS 83364-15-2) is a chemical compound with the molecular formula C8H12ClN5O and a molecular weight of 229.67 g/mol. IUPAC name: N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]acetamide. InChIKey: KIGOTEDYNQVLGZ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN5O |
|---|---|
| Molecular weight | 229.67 g/mol |
| IUPAC name | N-[4-chloro-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]acetamide |
| InChIKey | KIGOTEDYNQVLGZ-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=NC(=NC(=N1)Cl)NC(=O)C |
Computed by PubChem (NCBI)