Products 2253635-71-9
CAS 2253635-71-9 is the registry number for Antileishmanial agent-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl] 4-[1-(4-chlorophenyl)triazol-4-yl]butanoate (CAS 2253635-71-9) is a chemical compound with the molecular formula C27H24ClN3O4 and a molecular weight of 489.9 g/mol. IUPAC name: [3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl] 4-[1-(4-chlorophenyl)triazol-4-yl]butanoate. InChIKey: RKHHAANAPIAQJB-UHFFFAOYSA-N.
| Molecular formula | C27H24ClN3O4 |
|---|---|
| Molecular weight | 489.9 g/mol |
| IUPAC name | [3-(3-methylbut-2-enyl)-1,4-dioxonaphthalen-2-yl] 4-[1-(4-chlorophenyl)triazol-4-yl]butanoate |
| InChIKey | RKHHAANAPIAQJB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=O)C2=CC=CC=C2C1=O)OC(=O)CCCC3=CN(N=N3)C4=CC=C(C=C4)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
Antileishmanial agent-11, orb1686761