Products 261766-23-8
CAS 261766-23-8 appears in our catalog under these names: N–(4–acetamidophenyl)–Indomethacin amide, N-(4-acetamidophenyl)-Indomethacin amide. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 1 mg, 10 mg, 5 mg.
N-(4-acetamidophenyl)-2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetamide (CAS 261766-23-8) is a chemical compound with the molecular formula C27H24ClN3O4 and a molecular weight of 489.9 g/mol. IUPAC name: N-(4-acetamidophenyl)-2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetamide. InChIKey: CVMUUPNNEPVQCL-UHFFFAOYSA-N.
| Molecular formula | C27H24ClN3O4 |
|---|---|
| Molecular weight | 489.9 g/mol |
| IUPAC name | N-(4-acetamidophenyl)-2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetamide |
| InChIKey | CVMUUPNNEPVQCL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)NC4=CC=C(C=C4)NC(=O)C |
Computed by PubChem (NCBI)