CAS 2253640-01-4 is the registry number for 3-(3-(2-Methyl-1,3-thiazol-4-yl)benzenesulfonamido)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylamino]benzoic acid (CAS 2253640-01-4) is a chemical compound with the molecular formula C17H14N2O4S2 and a molecular weight of 374.4 g/mol. IUPAC name: 3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylamino]benzoic acid. InChIKey: KWXOAGTVYYJLJW-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S2 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylamino]benzoic acid |
| InChIKey | KWXOAGTVYYJLJW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)