CAS 920621-61-0 is the registry number for benzo(3,4-d)1,3-dioxolen-5-yl(3-pyridylmethyl)(2-thienylsulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide (CAS 920621-61-0) is a chemical compound with the molecular formula C17H14N2O4S2 and a molecular weight of 374.4 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide. InChIKey: PLQQKBIFNFFCLD-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S2 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide |
| InChIKey | PLQQKBIFNFFCLD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N(CC3=CN=CC=C3)S(=O)(=O)C4=CC=CS4 |
Computed by PubChem (NCBI)