Products 2253640-45-6
CAS 2253640-45-6 appears in our catalog under these names: 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-amine hydrochloride, 95%, 95%, 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride (CAS 2253640-45-6) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride. InChIKey: XKIRDQKEEORMID-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-amine;hydrochloride |
| InChIKey | XKIRDQKEEORMID-UHFFFAOYSA-N |
| SMILES | CC1(C2(CC(C2)(O1)C)N)C.Cl |
Computed by PubChem (NCBI)