CAS 2253641-14-2 appears in our catalog under these names: 4,5-Dimethoxy-2-fluorobenzylamine hydrochloride, (2-fluoro-4,5-dimethoxyphenyl)methanamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
(2-fluoro-4,5-dimethoxyphenyl)methanamine;hydrochloride (CAS 2253641-14-2) is a chemical compound with the molecular formula C9H13ClFNO2 and a molecular weight of 221.65 g/mol. IUPAC name: (2-fluoro-4,5-dimethoxyphenyl)methanamine;hydrochloride. InChIKey: OGBLRLMMBPLHJV-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFNO2 |
|---|---|
| Molecular weight | 221.65 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethoxyphenyl)methanamine;hydrochloride |
| InChIKey | OGBLRLMMBPLHJV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CN)F)OC.Cl |
Computed by PubChem (NCBI)