CAS 2566170-14-5 appears in our catalog under these names: (R)–2–Amino–2–(3–fluoro–5–methoxyphenyl)ethan–1–ol hydrochloride, (R)-2-Amino-2-(3-fluoro-5-methoxyphenyl)ethan-1-ol hydrochloride, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(3-fluoro-5-methoxyphenyl)ethanol;hydrochloride (CAS 2566170-14-5) is a chemical compound with the molecular formula C9H13ClFNO2 and a molecular weight of 221.65 g/mol. IUPAC name: (2R)-2-amino-2-(3-fluoro-5-methoxyphenyl)ethanol;hydrochloride. InChIKey: PNBVSZPLTNLKTL-FVGYRXGTSA-N.
| Molecular formula | C9H13ClFNO2 |
|---|---|
| Molecular weight | 221.65 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-fluoro-5-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | PNBVSZPLTNLKTL-FVGYRXGTSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@H](CO)N)F.Cl |
Computed by PubChem (NCBI)