Products 2253967-11-0
CAS 2253967-11-0 is the registry number for 4-Nitrophenyl Spiro[2.4]hepta-4,6-dien-1-ylmethyl Carbonate, >90.0%(qNMR). Offered by: TCI. Available pack sizes: 100mg, 500mg.
(4-nitrophenyl) spiro[2.4]hepta-4,6-dien-2-ylmethyl carbonate (CAS 2253967-11-0) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: (4-nitrophenyl) spiro[2.4]hepta-4,6-dien-2-ylmethyl carbonate. InChIKey: AFCAUCMVEPDDNL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | (4-nitrophenyl) spiro[2.4]hepta-4,6-dien-2-ylmethyl carbonate |
| InChIKey | AFCAUCMVEPDDNL-UHFFFAOYSA-N |
| SMILES | C1C(C12C=CC=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)