CAS 22556-62-3 appears in our catalog under these names: Lysophosphatidic acid, 95%, Lysophosphatidic acid (Oleyl form), Oleoyl-L-a-lysophosphatidic acid sodium salt, Oleoyl-L-a-lysophosphatidic acid sodium salt - Bio-X â„¢, (Rac)-1-Oleoyl lysophosphatidic acid (sodium), 98.0%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
Sodium [2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate (CAS 22556-62-3) is a chemical compound with the molecular formula C21H40NaO7P and a molecular weight of 458.5 g/mol. IUPAC name: sodium [2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate. InChIKey: XGRLSUFHELJJAB-KVVVOXFISA-M.
| Molecular formula | C21H40NaO7P |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | sodium [2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate |
| InChIKey | XGRLSUFHELJJAB-KVVVOXFISA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)[O-])O.[Na+] |
Computed by PubChem (NCBI)