CAS 325465-93-8 appears in our catalog under these names: 1-Oleoyl lysophosphatidic acid sodium, 97%, 1-Oleoyl lysophosphatidic acid sodium/ 99.24% (existing batch purity), 1–Oleoyl lysophosphatidic acid sodium salt, Oleoyl-L-alpha-lysophosphatidic acid sodium salt , 1-Oleoyl lysophosphatidic acid sodium 97%. Offered by: AmBeed, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 1g, 250mg.
Sodium [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate (CAS 325465-93-8) is a chemical compound with the molecular formula C21H40NaO7P and a molecular weight of 458.5 g/mol. IUPAC name: sodium [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate. InChIKey: XGRLSUFHELJJAB-JGSYTFBMSA-M.
| Molecular formula | C21H40NaO7P |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | sodium [(2R)-2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropyl] hydrogen phosphate |
| InChIKey | XGRLSUFHELJJAB-JGSYTFBMSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)[O-])O.[Na+] |
Computed by PubChem (NCBI)