Products 2256030-24-5
CAS 2256030-24-5 is the registry number for TRV045, 98.15%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 10 mg, 100 mg, 10mM/1mL.
2,2-diethyl-6-[3-(1H-pyrazol-4-yl)-1,2,4-oxadiazol-5-yl]-3H-chromen-4-one (CAS 2256030-24-5) is a chemical compound with the molecular formula C18H18N4O3 and a molecular weight of 338.4 g/mol. IUPAC name: 2,2-diethyl-6-[3-(1H-pyrazol-4-yl)-1,2,4-oxadiazol-5-yl]-3H-chromen-4-one. InChIKey: PNNITHGQTGQWGS-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 2,2-diethyl-6-[3-(1H-pyrazol-4-yl)-1,2,4-oxadiazol-5-yl]-3H-chromen-4-one |
| InChIKey | PNNITHGQTGQWGS-UHFFFAOYSA-N |
| SMILES | CCC1(CC(=O)C2=C(O1)C=CC(=C2)C3=NC(=NO3)C4=CNN=C4)CC |
Computed by PubChem (NCBI)