CAS 77469-62-6 is the registry number for Pimobendan Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(benzylamino)-3-nitrophenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (CAS 77469-62-6) is a chemical compound with the molecular formula C18H18N4O3 and a molecular weight of 338.4 g/mol. IUPAC name: 3-[4-(benzylamino)-3-nitrophenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one. InChIKey: YFJQPSKUCIGNDT-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 3-[4-(benzylamino)-3-nitrophenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | YFJQPSKUCIGNDT-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)NN=C1C2=CC(=C(C=C2)NCC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)