Products 2256054-73-4
CAS 2256054-73-4 is the registry number for Ethyl (S)-4-(piperidin-2-yl)benzoate hydrochloride, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride (CAS 2256054-73-4) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: ethyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride. InChIKey: QZFACTLWRVMGHV-ZOWNYOTGSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | ethyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride |
| InChIKey | QZFACTLWRVMGHV-ZOWNYOTGSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[C@@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)