Products 2256070-82-1
CAS 2256070-82-1 is the registry number for tert-Butyl 6-amino-2-oxospiro[indoline-3,3'-pyrrolidine]-1'-carboxylate, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 6-amino-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate (CAS 2256070-82-1) is a chemical compound with the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. IUPAC name: tert-butyl 6-amino-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate. InChIKey: XIGDGNGABCQLFD-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O3 |
|---|---|
| Molecular weight | 303.36 g/mol |
| IUPAC name | tert-butyl 6-amino-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxylate |
| InChIKey | XIGDGNGABCQLFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C3=C(C=C(C=C3)N)NC2=O |
Computed by PubChem (NCBI)