CAS 225656-63-3 is the registry number for 2-Methyl-5-(trifluoromethyl)benzyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(chloromethyl)-1-methyl-4-(trifluoromethyl)benzene (CAS 225656-63-3) is a chemical compound with the molecular formula C9H8ClF3 and a molecular weight of 208.61 g/mol. IUPAC name: 2-(chloromethyl)-1-methyl-4-(trifluoromethyl)benzene. InChIKey: ZUZJZUFMXLLABC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3 |
|---|---|
| Molecular weight | 208.61 g/mol |
| IUPAC name | 2-(chloromethyl)-1-methyl-4-(trifluoromethyl)benzene |
| InChIKey | ZUZJZUFMXLLABC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)