Products 85289-90-3
CAS 85289-90-3 appears in our catalog under these names: 1-(1-Chloroethyl)-4-(trifluoromethyl)benzene, 95%, 1-(1-Chloroethyl)-4-(trifluoromethyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(1-chloroethyl)-4-(trifluoromethyl)benzene (CAS 85289-90-3) is a chemical compound with the molecular formula C9H8ClF3 and a molecular weight of 208.61 g/mol. IUPAC name: 1-(1-chloroethyl)-4-(trifluoromethyl)benzene. InChIKey: CKKMRMKMZIDSDS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3 |
|---|---|
| Molecular weight | 208.61 g/mol |
| IUPAC name | 1-(1-chloroethyl)-4-(trifluoromethyl)benzene |
| InChIKey | CKKMRMKMZIDSDS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)