CAS 22568-11-2 appears in our catalog under these names: 3-[(E)-2-Nitroethenyl]pyridine, 98.0%, 98.0%, 3-[(E)-2-Nitroethenyl]pyridine, >98.0%(GC)(T). Offered by: Chemat, TCI. Available pack sizes: 5g.
3-[(E)-2-nitroethenyl]pyridine (CAS 22568-11-2) is a chemical compound with the molecular formula C7H6N2O2 and a molecular weight of 150.13 g/mol. IUPAC name: 3-[(E)-2-nitroethenyl]pyridine. InChIKey: HIXBXAXEKNYDHU-HWKANZROSA-N.
| Molecular formula | C7H6N2O2 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 3-[(E)-2-nitroethenyl]pyridine |
| InChIKey | HIXBXAXEKNYDHU-HWKANZROSA-N |
| SMILES | C1=CC(=CN=C1)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)