CAS 3156-52-3 appears in our catalog under these names: 3-(2-Nitroethenyl)pyridine, 95%, 3–((E)–2–Nitrovinyl)pyridine, 3-(2-Nitrovinyl)pyridine 98%, (E)-3-(2-Nitrovinyl)pyridine. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 10g, 5g, 250mg.
3-[(E)-2-nitroethenyl]pyridine (CAS 3156-52-3) is a chemical compound with the molecular formula C7H6N2O2 and a molecular weight of 150.13 g/mol. IUPAC name: 3-[(E)-2-nitroethenyl]pyridine. InChIKey: HIXBXAXEKNYDHU-HWKANZROSA-N.
| Molecular formula | C7H6N2O2 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 3-[(E)-2-nitroethenyl]pyridine |
| InChIKey | HIXBXAXEKNYDHU-HWKANZROSA-N |
| SMILES | C1=CC(=CN=C1)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)