CAS 2257427-45-3 is the registry number for TSI-13-57. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazol-5-yl]phenol (CAS 2257427-45-3) is a chemical compound with the molecular formula C28H29N3O3 and a molecular weight of 455.5 g/mol. IUPAC name: 4-[1-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazol-5-yl]phenol. InChIKey: KSIJIGHGXBEURD-UHFFFAOYSA-N.
| Molecular formula | C28H29N3O3 |
|---|---|
| Molecular weight | 455.5 g/mol |
| IUPAC name | 4-[1-(4-hydroxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]pyrazol-5-yl]phenol |
| InChIKey | KSIJIGHGXBEURD-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C3=NN(C(=C3)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)